C54H56N2S2 — CID 126598912
10-[4-[4-(1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazin-10-yl)phenyl]phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazine (PubChem CID 126598912) has the molecular formula C54H56N2S2 and a molecular weight of 797.19 g/mol. Its IUPAC name is 10-[4-[4-(1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazin-10-yl)phenyl]phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazine.
| Compound Name | 10-[4-[4-(1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazin-10-yl)phenyl]phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazine |
|---|---|
| PubChem CID | 126598912 |
| Molecular Formula | C54H56N2S2 |
| Molecular Weight | 797.19 g/mol |
| Exact Mass | 796.39 |
| IUPAC Name | 10-[4-[4-(1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazin-10-yl)phenyl]phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]phenothiazine |
| SMILES | CC1(C)c2cc3c(cc2C(C)(C)C1(C)C)N(c1ccc(-c2ccc(N4c5ccccc5Sc5cc6c(cc54)C(C)(C)C(C)(C)C6(C)C)cc2)cc1)c1ccccc1S3 |
| InChI | InChI=1S/C54H56N2S2/c1-49(2)37-29-43-47(31-39(37)51(5,6)53(49,9)10)57-45-19-15-13-17-41(45)55(43)35-25-21-33(22-26-35)34-23-27-36(28-24-34)56-42-18-14-16-20-46(42)58-48-32-40-38(30-44(48)56)50(3,4)54(11,12)52(40,7)8/h13-32H,1-12H3 |
| InChIKey | JBOQTZSYDOZSNG-UHFFFAOYSA-N |
| XLogP | 16.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.19 |
| LogP ≤ 5 | 16.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |