C33H25NO2S2 — CID 155244685
2-[4-(9,9-dimethylacridin-10-yl)phenyl]thianthrene 5,5-dioxide (PubChem CID 155244685) has the molecular formula C33H25NO2S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylacridin-10-yl)phenyl]thianthrene 5,5-dioxide.
| Compound Name | 2-[4-(9,9-dimethylacridin-10-yl)phenyl]thianthrene 5,5-dioxide |
|---|---|
| PubChem CID | 155244685 |
| Molecular Formula | C33H25NO2S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 2-[4-(9,9-dimethylacridin-10-yl)phenyl]thianthrene 5,5-dioxide |
| SMILES | CC1(C)c2ccccc2N(c2ccc(-c3ccc4c(c3)Sc3ccccc3S4(=O)=O)cc2)c2ccccc21 |
| InChI | InChI=1S/C33H25NO2S2/c1-33(2)25-9-3-5-11-27(25)34(28-12-6-4-10-26(28)33)24-18-15-22(16-19-24)23-17-20-32-30(21-23)37-29-13-7-8-14-31(29)38(32,35)36/h3-21H,1-2H3 |
| InChIKey | CTANMUGZTJGDBA-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |