C27H21NO2S2 — CID 130397699
9,9-dimethyl-3-phenothiazin-10-ylthioxanthene 10,10-dioxide (PubChem CID 130397699) has the molecular formula C27H21NO2S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 9,9-dimethyl-3-phenothiazin-10-ylthioxanthene 10,10-dioxide.
| Compound Name | 9,9-dimethyl-3-phenothiazin-10-ylthioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 130397699 |
| Molecular Formula | C27H21NO2S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 9,9-dimethyl-3-phenothiazin-10-ylthioxanthene 10,10-dioxide |
| SMILES | CC1(C)c2ccccc2S(=O)(=O)c2cc(N3c4ccccc4Sc4ccccc43)ccc21 |
| InChI | InChI=1S/C27H21NO2S2/c1-27(2)19-9-3-8-14-25(19)32(29,30)26-17-18(15-16-20(26)27)28-21-10-4-6-12-23(21)31-24-13-7-5-11-22(24)28/h3-17H,1-2H3 |
| InChIKey | WXPXIHFUZKNCFR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |