C48H36N2O4S4 — CID 130396379
3-[14-(9,9-dimethyl-10,10-dioxothioxanthen-3-yl)-[1,4]benzothiazino[2,3-b]phenothiazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide (PubChem CID 130396379) has the molecular formula C48H36N2O4S4 and a molecular weight of 833.09 g/mol. Its IUPAC name is 3-[14-(9,9-dimethyl-10,10-dioxothioxanthen-3-yl)-[1,4]benzothiazino[2,3-b]phenothiazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide.
| Compound Name | 3-[14-(9,9-dimethyl-10,10-dioxothioxanthen-3-yl)-[1,4]benzothiazino[2,3-b]phenothiazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 130396379 |
| Molecular Formula | C48H36N2O4S4 |
| Molecular Weight | 833.09 g/mol |
| Exact Mass | 832.16 |
| IUPAC Name | 3-[14-(9,9-dimethyl-10,10-dioxothioxanthen-3-yl)-[1,4]benzothiazino[2,3-b]phenothiazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide |
| SMILES | CC1(C)c2ccccc2S(=O)(=O)c2cc(-n3c4ccccc4sc4cc5c(cc43)sc3ccccc3n5-c3ccc4c(c3)S(=O)(=O)c3ccccc3C4(C)C)ccc21 |
| InChI | InChI=1S/C48H36N2O4S4/c1-47(2)31-13-5-11-19-43(31)57(51,52)45-25-29(21-23-33(45)47)49-35-15-7-9-17-39(35)55-41-28-38-42(27-37(41)49)56-40-18-10-8-16-36(40)50(38)30-22-24-34-46(26-30)58(53,54)44-20-12-6-14-32(44)48(34,3)4/h5-28H,1-4H3 |
| InChIKey | LWDKANYUEXLCAH-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.09 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|