C48H36N2O6S2 — CID 130396350
2-[14-(9,9-dimethyl-10,10-dioxothioxanthen-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide (PubChem CID 130396350) has the molecular formula C48H36N2O6S2 and a molecular weight of 800.96 g/mol. Its IUPAC name is 2-[14-(9,9-dimethyl-10,10-dioxothioxanthen-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide.
| Compound Name | 2-[14-(9,9-dimethyl-10,10-dioxothioxanthen-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 130396350 |
| Molecular Formula | C48H36N2O6S2 |
| Molecular Weight | 800.96 g/mol |
| Exact Mass | 800.20 |
| IUPAC Name | 2-[14-(9,9-dimethyl-10,10-dioxothioxanthen-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]-9,9-dimethylthioxanthene 10,10-dioxide |
| SMILES | CC1(C)c2ccccc2S(=O)(=O)c2ccc(-n3c4ccccc4oc4cc5c(cc43)oc3ccccc3n5-c3ccc4c(c3)C(C)(C)c3ccccc3S4(=O)=O)cc21 |
| InChI | InChI=1S/C48H36N2O6S2/c1-47(2)31-13-5-11-19-43(31)57(51,52)45-23-21-29(25-33(45)47)49-35-15-7-9-17-39(35)55-41-28-38-42(27-37(41)49)56-40-18-10-8-16-36(40)50(38)30-22-24-46-34(26-30)48(3,4)32-14-6-12-20-44(32)58(46,53)54/h5-28H,1-4H3 |
| InChIKey | HZVUAJLHFBAESP-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 104.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.96 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|