C42H24N2O6S4 — CID 130396373
3-[14-(10,10-dioxothianthren-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]thianthrene 5,5-dioxide (PubChem CID 130396373) has the molecular formula C42H24N2O6S4 and a molecular weight of 780.93 g/mol. Its IUPAC name is 3-[14-(10,10-dioxothianthren-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]thianthrene 5,5-dioxide.
| Compound Name | 3-[14-(10,10-dioxothianthren-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]thianthrene 5,5-dioxide |
|---|---|
| PubChem CID | 130396373 |
| Molecular Formula | C42H24N2O6S4 |
| Molecular Weight | 780.93 g/mol |
| Exact Mass | 780.05 |
| IUPAC Name | 3-[14-(10,10-dioxothianthren-2-yl)-[1,4]benzoxazino[2,3-b]phenoxazin-7-yl]thianthrene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2Sc2ccc(-n3c4ccccc4oc4cc5c(cc43)oc3ccccc3n5-c3ccc4c(c3)S(=O)(=O)c3ccccc3S4)cc21 |
| InChI | InChI=1S/C42H24N2O6S4/c45-53(46)39-15-7-5-13-35(39)51-37-19-17-25(21-41(37)53)43-27-9-1-3-11-31(27)49-33-24-30-34(23-29(33)43)50-32-12-4-2-10-28(32)44(30)26-18-20-38-42(22-26)54(47,48)40-16-8-6-14-36(40)52-38/h1-24H |
| InChIKey | NZRDOTYLMWWWJC-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 104.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.93 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|