C24H15NO2S — CID 135131341
3-carbazol-9-yldibenzothiophene 5,5-dioxide (PubChem CID 135131341) has the molecular formula C24H15NO2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-carbazol-9-yldibenzothiophene 5,5-dioxide.
| Compound Name | 3-carbazol-9-yldibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 135131341 |
| Molecular Formula | C24H15NO2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-carbazol-9-yldibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2-c2ccc(-n3c4ccccc4c4ccccc43)cc21 |
| InChI | InChI=1S/C24H15NO2S/c26-28(27)23-12-6-3-9-19(23)20-14-13-16(15-24(20)28)25-21-10-4-1-7-17(21)18-8-2-5-11-22(18)25/h1-15H |
| InChIKey | MMFIEORREMLOQQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |