C25H17NO2S — CID 126632614
3-(9-methylcarbazol-1-yl)dibenzothiophene 5,5-dioxide (PubChem CID 126632614) has the molecular formula C25H17NO2S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-(9-methylcarbazol-1-yl)dibenzothiophene 5,5-dioxide.
| Compound Name | 3-(9-methylcarbazol-1-yl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 126632614 |
| Molecular Formula | C25H17NO2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-(9-methylcarbazol-1-yl)dibenzothiophene 5,5-dioxide |
| SMILES | Cn1c2ccccc2c2cccc(-c3ccc4c(c3)S(=O)(=O)c3ccccc3-4)c21 |
| InChI | InChI=1S/C25H17NO2S/c1-26-22-11-4-2-7-18(22)21-10-6-9-17(25(21)26)16-13-14-20-19-8-3-5-12-23(19)29(27,28)24(20)15-16/h2-15H,1H3 |
| InChIKey | WBILJEXFRVHWPZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |