C44H26N2O3S2 — CID 122435447
2-[6-(5-methylindolo[3,2-b]carbazol-11-yl)dibenzothiophen-4-yl]-10,10-dioxothioxanthen-9-one (PubChem CID 122435447) has the molecular formula C44H26N2O3S2 and a molecular weight of 694.84 g/mol. Its IUPAC name is 2-[6-(5-methylindolo[3,2-b]carbazol-11-yl)dibenzothiophen-4-yl]-10,10-dioxothioxanthen-9-one.
| Compound Name | 2-[6-(5-methylindolo[3,2-b]carbazol-11-yl)dibenzothiophen-4-yl]-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 122435447 |
| Molecular Formula | C44H26N2O3S2 |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.14 |
| IUPAC Name | 2-[6-(5-methylindolo[3,2-b]carbazol-11-yl)dibenzothiophen-4-yl]-10,10-dioxothioxanthen-9-one |
| SMILES | Cn1c2ccccc2c2cc3c(cc21)c1ccccc1n3-c1cccc2c1sc1c(-c3ccc4c(c3)C(=O)c3ccccc3S4(=O)=O)cccc12 |
| InChI | InChI=1S/C44H26N2O3S2/c1-45-35-16-5-2-10-27(35)32-24-39-33(23-38(32)45)28-11-3-6-17-36(28)46(39)37-18-9-15-30-29-14-8-13-26(43(29)50-44(30)37)25-20-21-41-34(22-25)42(47)31-12-4-7-19-40(31)51(41,48)49/h2-24H,1H3 |
| InChIKey | AEMJPBXLJVWQPV-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |