C44H22O6S4 — CID 155081430
10,10-dioxo-2-[12-(9,10,10-trioxothioxanthen-2-yl)-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-2-yl]thioxanthen-9-one (PubChem CID 155081430) has the molecular formula C44H22O6S4 and a molecular weight of 774.92 g/mol. Its IUPAC name is 10,10-dioxo-2-[12-(9,10,10-trioxothioxanthen-2-yl)-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-2-yl]thioxanthen-9-one.
| Compound Name | 10,10-dioxo-2-[12-(9,10,10-trioxothioxanthen-2-yl)-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-2-yl]thioxanthen-9-one |
|---|---|
| PubChem CID | 155081430 |
| Molecular Formula | C44H22O6S4 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.03 |
| IUPAC Name | 10,10-dioxo-2-[12-(9,10,10-trioxothioxanthen-2-yl)-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-2-yl]thioxanthen-9-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)c2ccc(-c3c4sc5ccccc5c4c(-c4ccc5c(c4)C(=O)c4ccccc4S5(=O)=O)c4sc5ccccc5c34)cc21 |
| InChI | InChI=1S/C44H22O6S4/c45-41-27-11-3-7-15-33(27)53(47,48)35-19-17-23(21-29(35)41)37-39-25-9-1-5-13-31(25)51-43(39)38(40-26-10-2-6-14-32(26)52-44(37)40)24-18-20-36-30(22-24)42(46)28-12-4-8-16-34(28)54(36,49)50/h1-22H |
| InChIKey | SHIUBCCSYDFKGJ-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |