C56H32N2O6S2 — CID 155081222
3-[5,11-diphenyl-12-(9,10,10-trioxothioxanthen-3-yl)indolo[3,2-b]carbazol-6-yl]-10,10-dioxothioxanthen-9-one (PubChem CID 155081222) has the molecular formula C56H32N2O6S2 and a molecular weight of 893.01 g/mol. Its IUPAC name is 3-[5,11-diphenyl-12-(9,10,10-trioxothioxanthen-3-yl)indolo[3,2-b]carbazol-6-yl]-10,10-dioxothioxanthen-9-one.
| Compound Name | 3-[5,11-diphenyl-12-(9,10,10-trioxothioxanthen-3-yl)indolo[3,2-b]carbazol-6-yl]-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 155081222 |
| Molecular Formula | C56H32N2O6S2 |
| Molecular Weight | 893.01 g/mol |
| Exact Mass | 892.17 |
| IUPAC Name | 3-[5,11-diphenyl-12-(9,10,10-trioxothioxanthen-3-yl)indolo[3,2-b]carbazol-6-yl]-10,10-dioxothioxanthen-9-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)c2cc(-c3c4c5ccccc5n(-c5ccccc5)c4c(-c4ccc5c(c4)S(=O)(=O)c4ccccc4C5=O)c4c5ccccc5n(-c5ccccc5)c34)ccc21 |
| InChI | InChI=1S/C56H32N2O6S2/c59-55-39-21-9-13-25-45(39)65(61,62)47-31-33(27-29-41(47)55)49-52-38-20-8-12-24-44(38)58(36-17-5-2-6-18-36)54(52)50(51-37-19-7-11-23-43(37)57(53(49)51)35-15-3-1-4-16-35)34-28-30-42-48(32-34)66(63,64)46-26-14-10-22-40(46)56(42)60/h1-32H |
| InChIKey | SQCMELGUXVLAKQ-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 112.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.01 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |