C38H27NO2SSi — CID 148817621
3-(11,11-dimethyl-5-phenyl-[1]benzosilolo[3,2-b]carbazol-2-yl)dibenzothiophene 5,5-dioxide (PubChem CID 148817621) has the molecular formula C38H27NO2SSi and a molecular weight of 589.79 g/mol. Its IUPAC name is 3-(11,11-dimethyl-5-phenyl-[1]benzosilolo[3,2-b]carbazol-2-yl)dibenzothiophene 5,5-dioxide.
| Compound Name | 3-(11,11-dimethyl-5-phenyl-[1]benzosilolo[3,2-b]carbazol-2-yl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 148817621 |
| Molecular Formula | C38H27NO2SSi |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | 3-(11,11-dimethyl-5-phenyl-[1]benzosilolo[3,2-b]carbazol-2-yl)dibenzothiophene 5,5-dioxide |
| SMILES | C[Si]1(C)c2ccccc2-c2cc3c(cc21)c1cc(-c2ccc4c(c2)S(=O)(=O)c2ccccc2-4)ccc1n3-c1ccccc1 |
| InChI | InChI=1S/C38H27NO2SSi/c1-43(2)37-15-9-7-13-29(37)32-22-34-31(23-38(32)43)30-20-24(17-19-33(30)39(34)26-10-4-3-5-11-26)25-16-18-28-27-12-6-8-14-35(27)42(40,41)36(28)21-25/h3-23H,1-2H3 |
| InChIKey | ORDNFSVZRBJGPJ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|