C29H19NO2S — CID 126632627
3-(5-methylbenzo[b]carbazol-2-yl)dibenzothiophene 5,5-dioxide (PubChem CID 126632627) has the molecular formula C29H19NO2S and a molecular weight of 445.54 g/mol. Its IUPAC name is 3-(5-methylbenzo[b]carbazol-2-yl)dibenzothiophene 5,5-dioxide.
| Compound Name | 3-(5-methylbenzo[b]carbazol-2-yl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 126632627 |
| Molecular Formula | C29H19NO2S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 3-(5-methylbenzo[b]carbazol-2-yl)dibenzothiophene 5,5-dioxide |
| SMILES | Cn1c2ccc(-c3ccc4c(c3)S(=O)(=O)c3ccccc3-4)cc2c2cc3ccccc3cc21 |
| InChI | InChI=1S/C29H19NO2S/c1-30-26-13-11-20(15-24(26)25-14-18-6-2-3-7-19(18)16-27(25)30)21-10-12-23-22-8-4-5-9-28(22)33(31,32)29(23)17-21/h2-17H,1H3 |
| InChIKey | XGTIVKCAMYNPKY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |