C28H18O2S — CID 122485077
5-(4-phenylphenyl)-8λ6-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene 8,8-dioxide (PubChem CID 122485077) has the molecular formula C28H18O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-8λ6-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene 8,8-dioxide.
| Compound Name | 5-(4-phenylphenyl)-8λ6-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene 8,8-dioxide |
|---|---|
| PubChem CID | 122485077 |
| Molecular Formula | C28H18O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-(4-phenylphenyl)-8λ6-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene 8,8-dioxide |
| SMILES | O=S1(=O)c2cc(-c3ccc(-c4ccccc4)cc3)ccc2-c2cccc3cccc1c23 |
| InChI | InChI=1S/C28H18O2S/c29-31(30)26-11-5-9-22-8-4-10-25(28(22)26)24-17-16-23(18-27(24)31)21-14-12-20(13-15-21)19-6-2-1-3-7-19/h1-18H |
| InChIKey | BYQMYBZOCJUNMK-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |