C15H11NO2S — CID 138982392
6-methyl-[1]benzothiolo[2,3-b]indole 5,5-dioxide (PubChem CID 138982392) has the molecular formula C15H11NO2S and a molecular weight of 269.32 g/mol. Its IUPAC name is 6-methyl-[1]benzothiolo[2,3-b]indole 5,5-dioxide.
| Compound Name | 6-methyl-[1]benzothiolo[2,3-b]indole 5,5-dioxide |
|---|---|
| PubChem CID | 138982392 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 6-methyl-[1]benzothiolo[2,3-b]indole 5,5-dioxide |
| SMILES | Cn1c2c(c3ccccc31)-c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C15H11NO2S/c1-16-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)19(17,18)15(14)16/h2-9H,1H3 |
| InChIKey | AHWDVHXZMVEAFU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |