C42H33NO3S — CID 134579078
2-[6-(9,9-dimethylacridin-10-yl)-9,9-dimethylxanthen-3-yl]dibenzothiophene 5,5-dioxide (PubChem CID 134579078) has the molecular formula C42H33NO3S and a molecular weight of 631.80 g/mol. Its IUPAC name is 2-[6-(9,9-dimethylacridin-10-yl)-9,9-dimethylxanthen-3-yl]dibenzothiophene 5,5-dioxide.
| Compound Name | 2-[6-(9,9-dimethylacridin-10-yl)-9,9-dimethylxanthen-3-yl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 134579078 |
| Molecular Formula | C42H33NO3S |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 2-[6-(9,9-dimethylacridin-10-yl)-9,9-dimethylxanthen-3-yl]dibenzothiophene 5,5-dioxide |
| SMILES | CC1(C)c2ccc(-c3ccc4c(c3)-c3ccccc3S4(=O)=O)cc2Oc2cc(N3c4ccccc4C(C)(C)c4ccccc43)ccc21 |
| InChI | InChI=1S/C42H33NO3S/c1-41(2)31-12-6-8-14-35(31)43(36-15-9-7-13-32(36)41)28-19-21-34-38(25-28)46-37-24-27(17-20-33(37)42(34,3)4)26-18-22-40-30(23-26)29-11-5-10-16-39(29)47(40,44)45/h5-25H,1-4H3 |
| InChIKey | AXNQQVZHFOYXFE-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |