C18H20BrN — CID 107084024
3-[4-(bromomethyl)-3-methylphenyl]-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 107084024) has the molecular formula C18H20BrN and a molecular weight of 330.27 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-3-methylphenyl]-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-[4-(bromomethyl)-3-methylphenyl]-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 107084024 |
| Molecular Formula | C18H20BrN |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[4-(bromomethyl)-3-methylphenyl]-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | Cc1cc(N2CCc3ccccc3CC2)ccc1CBr |
| InChI | InChI=1S/C18H20BrN/c1-14-12-18(7-6-17(14)13-19)20-10-8-15-4-2-3-5-16(15)9-11-20/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | UMBZJGBYUQDULV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|