C14H20BrNS — CID 107083907
4-[4-(bromomethyl)-3-methylphenyl]-2,6-dimethylthiomorpholine (PubChem CID 107083907) has the molecular formula C14H20BrNS and a molecular weight of 314.29 g/mol. Its IUPAC name is 4-[4-(bromomethyl)-3-methylphenyl]-2,6-dimethylthiomorpholine.
| Compound Name | 4-[4-(bromomethyl)-3-methylphenyl]-2,6-dimethylthiomorpholine |
|---|---|
| PubChem CID | 107083907 |
| Molecular Formula | C14H20BrNS |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-[4-(bromomethyl)-3-methylphenyl]-2,6-dimethylthiomorpholine |
| SMILES | Cc1cc(N2CC(C)SC(C)C2)ccc1CBr |
| InChI | InChI=1S/C14H20BrNS/c1-10-6-14(5-4-13(10)7-15)16-8-11(2)17-12(3)9-16/h4-6,11-12H,7-9H2,1-3H3 |
| InChIKey | UNNRPSVQRAPXFA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|