C15H15BrN2 — CID 114056909
2-[3-(bromomethyl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 114056909) has the molecular formula C15H15BrN2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-[3-(bromomethyl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[3-(bromomethyl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 114056909 |
| Molecular Formula | C15H15BrN2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-[3-(bromomethyl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | BrCc1cccnc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H15BrN2/c16-10-13-6-3-8-17-15(13)18-9-7-12-4-1-2-5-14(12)11-18/h1-6,8H,7,9-11H2 |
| InChIKey | CBURTPXCVGYMMP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|