About [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine
[2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine (PubChem CID 68582946) has the molecular formula C11H15F2N3
and a molecular weight of 227.26 g/mol. Its IUPAC name is [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine |
| PubChem CID | 68582946 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1cccnc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H15F2N3/c12-11(13)3-6-16(7-4-11)10-9(8-14)2-1-5-15-10/h1-2,5H,3-4,6-8,14H2 |
| InChIKey | BXGNPHMCZVYAFE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine?
The IUPAC name of [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine (CID 68582946) is [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine.
What is the SMILES notation for [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine?
The canonical SMILES for [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine is NCc1cccnc1N1CCC(F)(F)CC1.
What is the InChIKey of [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine?
The InChIKey is BXGNPHMCZVYAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N3/c12-11(13)3-6-16(7-4-11)10-9(8-14)2-1-5-15-10/h1-2,5H,3-4,6-8,14H2.
What are the key properties of [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine?
[2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine has a molecular weight of 227.26 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine is sourced from PubChem (CID 68582946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).