C11H15F2N3 — CID 68582946
[2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine (PubChem CID 68582946) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine.
| Compound Name | [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 68582946 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | [2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1cccnc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H15F2N3/c12-11(13)3-6-16(7-4-11)10-9(8-14)2-1-5-15-10/h1-2,5H,3-4,6-8,14H2 |
| InChIKey | BXGNPHMCZVYAFE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |