C12H20N4 — CID 63605164
[2-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanamine (PubChem CID 63605164) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is [2-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanamine.
| Compound Name | [2-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 63605164 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [2-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanamine |
| SMILES | CC1CN(c2ncccc2CN)CCN1C |
| InChI | InChI=1S/C12H20N4/c1-10-9-16(7-6-15(10)2)12-11(8-13)4-3-5-14-12/h3-5,10H,6-9,13H2,1-2H3 |
| InChIKey | HUZHQTAQWFRMBK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |