C11H16ClN3 — CID 71195511
4-(3-chloro-2-pyridinyl)-1,2-dimethylpiperazine (PubChem CID 71195511) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 4-(3-chloro-2-pyridinyl)-1,2-dimethylpiperazine.
| Compound Name | 4-(3-chloro-2-pyridinyl)-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 71195511 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-(3-chloro-2-pyridinyl)-1,2-dimethylpiperazine |
| SMILES | CC1CN(c2ncccc2Cl)CCN1C |
| InChI | InChI=1S/C11H16ClN3/c1-9-8-15(7-6-14(9)2)11-10(12)4-3-5-13-11/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | PVIJBVWVDMNAKE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |