C10H15ClN4 — CID 63604413
3-chloro-6-(3,4-dimethylpiperazin-1-yl)pyridazine (PubChem CID 63604413) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 3-chloro-6-(3,4-dimethylpiperazin-1-yl)pyridazine.
| Compound Name | 3-chloro-6-(3,4-dimethylpiperazin-1-yl)pyridazine |
|---|---|
| PubChem CID | 63604413 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-chloro-6-(3,4-dimethylpiperazin-1-yl)pyridazine |
| SMILES | CC1CN(c2ccc(Cl)nn2)CCN1C |
| InChI | InChI=1S/C10H15ClN4/c1-8-7-15(6-5-14(8)2)10-4-3-9(11)12-13-10/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | RGBIDLKYEXGFGQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |