C13H21ClN4 — CID 167504088
(3R)-N-tert-butyl-1-(6-chloropyridazin-3-yl)-N-methylpyrrolidin-3-amine (PubChem CID 167504088) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is (3R)-N-tert-butyl-1-(6-chloropyridazin-3-yl)-N-methylpyrrolidin-3-amine.
| Compound Name | (3R)-N-tert-butyl-1-(6-chloropyridazin-3-yl)-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 167504088 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (3R)-N-tert-butyl-1-(6-chloropyridazin-3-yl)-N-methylpyrrolidin-3-amine |
| SMILES | CN([C@@H]1CCN(c2ccc(Cl)nn2)C1)C(C)(C)C |
| InChI | InChI=1S/C13H21ClN4/c1-13(2,3)17(4)10-7-8-18(9-10)12-6-5-11(14)15-16-12/h5-6,10H,7-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | HERACZPTWQBTKV-SNVBAGLBSA-N |
| XLogP | 2.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |