C15H22ClN5O — CID 96557217
[(3R)-1-(6-chloropyridazin-3-yl)piperidin-3-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 96557217) has the molecular formula C15H22ClN5O and a molecular weight of 323.83 g/mol. Its IUPAC name is [(3R)-1-(6-chloropyridazin-3-yl)piperidin-3-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(3R)-1-(6-chloropyridazin-3-yl)piperidin-3-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 96557217 |
| Molecular Formula | C15H22ClN5O |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [(3R)-1-(6-chloropyridazin-3-yl)piperidin-3-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)[C@@H]2CCCN(c3ccc(Cl)nn3)C2)CC1 |
| InChI | InChI=1S/C15H22ClN5O/c1-19-7-9-20(10-8-19)15(22)12-3-2-6-21(11-12)14-5-4-13(16)17-18-14/h4-5,12H,2-3,6-11H2,1H3/t12-/m1/s1 |
| InChIKey | MDUJEFWBOBTLTD-GFCCVEGCSA-N |
| XLogP | 1.12 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |