C22H26ClN5O2 — CID 75361395
[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone (PubChem CID 75361395) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is [4-(6-chloropyridazin-3-yl)piperazin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone.
| Compound Name | [4-(6-chloropyridazin-3-yl)piperazin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 75361395 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [4-(6-chloropyridazin-3-yl)piperazin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)N3CCN(c4ccc(Cl)nn4)CC3)C2)cc1 |
| InChI | InChI=1S/C22H26ClN5O2/c1-16-4-6-17(7-5-16)21(29)28-10-2-3-18(15-28)22(30)27-13-11-26(12-14-27)20-9-8-19(23)24-25-20/h4-9,18H,2-3,10-15H2,1H3 |
| InChIKey | WHVGBVQOHPLTBH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |