C11H18N4O — CID 63635194
[6-(3,4-dimethylpiperazin-1-yl)pyridazin-3-yl]methanol (PubChem CID 63635194) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is [6-(3,4-dimethylpiperazin-1-yl)pyridazin-3-yl]methanol.
| Compound Name | [6-(3,4-dimethylpiperazin-1-yl)pyridazin-3-yl]methanol |
|---|---|
| PubChem CID | 63635194 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [6-(3,4-dimethylpiperazin-1-yl)pyridazin-3-yl]methanol |
| SMILES | CC1CN(c2ccc(CO)nn2)CCN1C |
| InChI | InChI=1S/C11H18N4O/c1-9-7-15(6-5-14(9)2)11-4-3-10(8-16)12-13-11/h3-4,9,16H,5-8H2,1-2H3 |
| InChIKey | XMTUTEPYGGLFHQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |