C9H11N3O — CID 130735742
[6-(2,5-dihydropyrrol-1-yl)pyridazin-3-yl]methanol (PubChem CID 130735742) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is [6-(2,5-dihydropyrrol-1-yl)pyridazin-3-yl]methanol.
| Compound Name | [6-(2,5-dihydropyrrol-1-yl)pyridazin-3-yl]methanol |
|---|---|
| PubChem CID | 130735742 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | [6-(2,5-dihydropyrrol-1-yl)pyridazin-3-yl]methanol |
| SMILES | OCc1ccc(N2CC=CC2)nn1 |
| InChI | InChI=1S/C9H11N3O/c13-7-8-3-4-9(11-10-8)12-5-1-2-6-12/h1-4,13H,5-7H2 |
| InChIKey | UZTHYEWCIODVGS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|