C10H15N3OS — CID 61419204
[6-(1,4-thiazepan-4-yl)pyridazin-3-yl]methanol (PubChem CID 61419204) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is [6-(1,4-thiazepan-4-yl)pyridazin-3-yl]methanol.
| Compound Name | [6-(1,4-thiazepan-4-yl)pyridazin-3-yl]methanol |
|---|---|
| PubChem CID | 61419204 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | [6-(1,4-thiazepan-4-yl)pyridazin-3-yl]methanol |
| SMILES | OCc1ccc(N2CCCSCC2)nn1 |
| InChI | InChI=1S/C10H15N3OS/c14-8-9-2-3-10(12-11-9)13-4-1-6-15-7-5-13/h2-3,14H,1,4-8H2 |
| InChIKey | RQFXOERCIMOJFF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |