C11H15ClN2OS — CID 61419845
[3-chloro-6-(1,4-thiazepan-4-yl)-2-pyridinyl]methanol (PubChem CID 61419845) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is [3-chloro-6-(1,4-thiazepan-4-yl)-2-pyridinyl]methanol.
| Compound Name | [3-chloro-6-(1,4-thiazepan-4-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 61419845 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | [3-chloro-6-(1,4-thiazepan-4-yl)-2-pyridinyl]methanol |
| SMILES | OCc1nc(N2CCCSCC2)ccc1Cl |
| InChI | InChI=1S/C11H15ClN2OS/c12-9-2-3-11(13-10(9)8-15)14-4-1-6-16-7-5-14/h2-3,15H,1,4-8H2 |
| InChIKey | PLFOHBFLKDOABR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |