About [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol
[3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol (PubChem CID 114412403) has the molecular formula C12H15ClN2O
and a molecular weight of 238.72 g/mol. Its IUPAC name is [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol |
| PubChem CID | 114412403 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol |
| SMILES | CC1=CCN(c2ccc(Cl)c(CO)n2)CC1 |
| InChI | InChI=1S/C12H15ClN2O/c1-9-4-6-15(7-5-9)12-3-2-10(13)11(8-16)14-12/h2-4,16H,5-8H2,1H3 |
| InChIKey | WVNAHIMYHJNPGY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol?
The IUPAC name of [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol (CID 114412403) is [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol.
What is the SMILES notation for [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol?
The canonical SMILES for [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol is CC1=CCN(c2ccc(Cl)c(CO)n2)CC1.
What is the InChIKey of [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol?
The InChIKey is WVNAHIMYHJNPGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O/c1-9-4-6-15(7-5-9)12-3-2-10(13)11(8-16)14-12/h2-4,16H,5-8H2,1H3.
What are the key properties of [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol?
[3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol has a molecular weight of 238.72 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanol is sourced from PubChem (CID 114412403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).