C13H19N3 — CID 114412685
[2-methyl-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanamine (PubChem CID 114412685) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanamine.
| Compound Name | [2-methyl-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 114412685 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | [2-methyl-6-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanamine |
| SMILES | CC1=CCN(c2ccc(CN)c(C)n2)CC1 |
| InChI | InChI=1S/C13H19N3/c1-10-5-7-16(8-6-10)13-4-3-12(9-14)11(2)15-13/h3-5H,6-9,14H2,1-2H3 |
| InChIKey | KRPWXUFCJPGMCQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|