C16H23N3 — CID 114459755
[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-5,6,7,8-tetrahydroquinolin-3-yl]methanamine (PubChem CID 114459755) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is [2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-5,6,7,8-tetrahydroquinolin-3-yl]methanamine.
| Compound Name | [2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-5,6,7,8-tetrahydroquinolin-3-yl]methanamine |
|---|---|
| PubChem CID | 114459755 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | [2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-5,6,7,8-tetrahydroquinolin-3-yl]methanamine |
| SMILES | CC1=CCN(c2nc3c(cc2CN)CCCC3)CC1 |
| InChI | InChI=1S/C16H23N3/c1-12-6-8-19(9-7-12)16-14(11-17)10-13-4-2-3-5-15(13)18-16/h6,10H,2-5,7-9,11,17H2,1H3 |
| InChIKey | NPNAKAWFZGPQJN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|