C14H18N4O2 — CID 66085814
4-[3-(aminomethyl)-5,6,7,8-tetrahydroquinolin-2-yl]piperazine-2,6-dione (PubChem CID 66085814) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-5,6,7,8-tetrahydroquinolin-2-yl]piperazine-2,6-dione.
| Compound Name | 4-[3-(aminomethyl)-5,6,7,8-tetrahydroquinolin-2-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66085814 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[3-(aminomethyl)-5,6,7,8-tetrahydroquinolin-2-yl]piperazine-2,6-dione |
| SMILES | NCc1cc2c(nc1N1CC(=O)NC(=O)C1)CCCC2 |
| InChI | InChI=1S/C14H18N4O2/c15-6-10-5-9-3-1-2-4-11(9)16-14(10)18-7-12(19)17-13(20)8-18/h5H,1-4,6-8,15H2,(H,17,19,20) |
| InChIKey | DGEDSQNUDLJTJX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|