C9H12ClN3S — CID 61423484
4-(6-chloropyridazin-3-yl)-1,4-thiazepane (PubChem CID 61423484) has the molecular formula C9H12ClN3S and a molecular weight of 229.74 g/mol. Its IUPAC name is 4-(6-chloropyridazin-3-yl)-1,4-thiazepane.
| Compound Name | 4-(6-chloropyridazin-3-yl)-1,4-thiazepane |
|---|---|
| PubChem CID | 61423484 |
| Molecular Formula | C9H12ClN3S |
| Molecular Weight | 229.74 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 4-(6-chloropyridazin-3-yl)-1,4-thiazepane |
| SMILES | Clc1ccc(N2CCCSCC2)nn1 |
| InChI | InChI=1S/C9H12ClN3S/c10-8-2-3-9(12-11-8)13-4-1-6-14-7-5-13/h2-3H,1,4-7H2 |
| InChIKey | FUKKPTFCCJGWDS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |