C14H19N3O — CID 68583511
[2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-3-pyridinyl]methanamine (PubChem CID 68583511) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is [2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-3-pyridinyl]methanamine.
| Compound Name | [2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 68583511 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | [2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-3-pyridinyl]methanamine |
| SMILES | NCc1cccnc1N1C[C@@H]2C3CCC(O3)[C@@H]2C1 |
| InChI | InChI=1S/C14H19N3O/c15-6-9-2-1-5-16-14(9)17-7-10-11(8-17)13-4-3-12(10)18-13/h1-2,5,10-13H,3-4,6-8,15H2/t10-,11+,12?,13? |
| InChIKey | MMBJCFKEBXIJPG-MPEURRAXSA-N |
| XLogP | 1.15 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |