C15H16N6O — CID 139021935
1-[1-oxo-1-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)propan-2-yl]-1,2,4-triazole-3-carbonitrile (PubChem CID 139021935) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[1-oxo-1-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)propan-2-yl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[1-oxo-1-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)propan-2-yl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 139021935 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[1-oxo-1-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)propan-2-yl]-1,2,4-triazole-3-carbonitrile |
| SMILES | CC(C(=O)N1CCCCc2cccnc21)n1cnc(C#N)n1 |
| InChI | InChI=1S/C15H16N6O/c1-11(21-10-18-13(9-16)19-21)15(22)20-8-3-2-5-12-6-4-7-17-14(12)20/h4,6-7,10-11H,2-3,5,8H2,1H3 |
| InChIKey | PHOADTCBKKHINP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |