C16H15IN2O — CID 166241202
3,4-dihydro-2H-1,8-naphthyridin-1-yl-(4-iodo-3-methylphenyl)methanone (PubChem CID 166241202) has the molecular formula C16H15IN2O and a molecular weight of 378.21 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,8-naphthyridin-1-yl-(4-iodo-3-methylphenyl)methanone.
| Compound Name | 3,4-dihydro-2H-1,8-naphthyridin-1-yl-(4-iodo-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 166241202 |
| Molecular Formula | C16H15IN2O |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 3,4-dihydro-2H-1,8-naphthyridin-1-yl-(4-iodo-3-methylphenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCc3cccnc32)ccc1I |
| InChI | InChI=1S/C16H15IN2O/c1-11-10-13(6-7-14(11)17)16(20)19-9-3-5-12-4-2-8-18-15(12)19/h2,4,6-8,10H,3,5,9H2,1H3 |
| InChIKey | KTSXCCSWQBLLMY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|