C14H16N4O3 — CID 154591723
N-[(3R)-2,6-dioxopiperidin-3-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 154591723) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-[(3R)-2,6-dioxopiperidin-3-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[(3R)-2,6-dioxopiperidin-3-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 154591723 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-[(3R)-2,6-dioxopiperidin-3-yl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | O=C1CC[C@@H](NC(=O)N2CCCc3cccnc32)C(=O)N1 |
| InChI | InChI=1S/C14H16N4O3/c19-11-6-5-10(13(20)17-11)16-14(21)18-8-2-4-9-3-1-7-15-12(9)18/h1,3,7,10H,2,4-6,8H2,(H,16,21)(H,17,19,20)/t10-/m1/s1 |
| InChIKey | JNFKCVUMZWHHQP-SNVBAGLBSA-N |
| XLogP | 0.35 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|