C20H29N3O3 — CID 156745105
(E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-methyl-3-pyridinyl)but-2-enamide;2-methylbutane (PubChem CID 156745105) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-methyl-3-pyridinyl)but-2-enamide;2-methylbutane.
| Compound Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-methyl-3-pyridinyl)but-2-enamide;2-methylbutane |
|---|---|
| PubChem CID | 156745105 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-methyl-3-pyridinyl)but-2-enamide;2-methylbutane |
| SMILES | C/C=C(/C(=O)NC1CCC(=O)NC1=O)c1cccnc1C.CCC(C)C |
| InChI | InChI=1S/C15H17N3O3.C5H12/c1-3-10(11-5-4-8-16-9(11)2)14(20)17-12-6-7-13(19)18-15(12)21;1-4-5(2)3/h3-5,8,12H,6-7H2,1-2H3,(H,17,20)(H,18,19,21);5H,4H2,1-3H3/b10-3+; |
| InChIKey | RCLFQWSJXBXASD-ORVWSRSGSA-N |
| XLogP | 2.77 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|