C9H8FNO — CID 166885117
6-fluoro-7,8-dihydro-6H-quinolin-5-one (PubChem CID 166885117) has the molecular formula C9H8FNO and a molecular weight of 165.17 g/mol. Its IUPAC name is 6-fluoro-7,8-dihydro-6H-quinolin-5-one.
| Compound Name | 6-fluoro-7,8-dihydro-6H-quinolin-5-one |
|---|---|
| PubChem CID | 166885117 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 6-fluoro-7,8-dihydro-6H-quinolin-5-one |
| SMILES | O=C1c2cccnc2CCC1F |
| InChI | InChI=1S/C9H8FNO/c10-7-3-4-8-6(9(7)12)2-1-5-11-8/h1-2,5,7H,3-4H2 |
| InChIKey | GTWPTFOKCJHZLZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |