About 6-fluoro-7,8-dihydro-6H-quinolin-5-one
6-fluoro-7,8-dihydro-6H-quinolin-5-one (PubChem CID 166885117) has the molecular formula C9H8FNO
and a molecular weight of 165.17 g/mol. Its IUPAC name is 6-fluoro-7,8-dihydro-6H-quinolin-5-one.
Molecular Properties
| Compound Name | 6-fluoro-7,8-dihydro-6H-quinolin-5-one |
| PubChem CID | 166885117 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 6-fluoro-7,8-dihydro-6H-quinolin-5-one |
| SMILES | O=C1c2cccnc2CCC1F |
| InChI | InChI=1S/C9H8FNO/c10-7-3-4-8-6(9(7)12)2-1-5-11-8/h1-2,5,7H,3-4H2 |
| InChIKey | GTWPTFOKCJHZLZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-7,8-dihydro-6H-quinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7,8-dihydro-6H-quinolin-5-one?
The IUPAC name of 6-fluoro-7,8-dihydro-6H-quinolin-5-one (CID 166885117) is 6-fluoro-7,8-dihydro-6H-quinolin-5-one.
What is the SMILES notation for 6-fluoro-7,8-dihydro-6H-quinolin-5-one?
The canonical SMILES for 6-fluoro-7,8-dihydro-6H-quinolin-5-one is O=C1c2cccnc2CCC1F.
What is the InChIKey of 6-fluoro-7,8-dihydro-6H-quinolin-5-one?
The InChIKey is GTWPTFOKCJHZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO/c10-7-3-4-8-6(9(7)12)2-1-5-11-8/h1-2,5,7H,3-4H2.
What are the key properties of 6-fluoro-7,8-dihydro-6H-quinolin-5-one?
6-fluoro-7,8-dihydro-6H-quinolin-5-one has a molecular weight of 165.17 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7,8-dihydro-6H-quinolin-5-one is sourced from PubChem (CID 166885117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).