C13H8N2O4S — CID 91536083
1,1-dioxo-2-(pyrimidine-2-carbonyl)-1-benzothiophen-3-one (PubChem CID 91536083) has the molecular formula C13H8N2O4S and a molecular weight of 288.28 g/mol. Its IUPAC name is 1,1-dioxo-2-(pyrimidine-2-carbonyl)-1-benzothiophen-3-one.
| Compound Name | 1,1-dioxo-2-(pyrimidine-2-carbonyl)-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 91536083 |
| Molecular Formula | C13H8N2O4S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1,1-dioxo-2-(pyrimidine-2-carbonyl)-1-benzothiophen-3-one |
| SMILES | O=C(c1ncccn1)C1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H8N2O4S/c16-10-8-4-1-2-5-9(8)20(18,19)12(10)11(17)13-14-6-3-7-15-13/h1-7,12H |
| InChIKey | UICOFBURVDFYRW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|