C17H13NO6S — CID 91369564
3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzoic acid (PubChem CID 91369564) has the molecular formula C17H13NO6S and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzoic acid.
| Compound Name | 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 91369564 |
| Molecular Formula | C17H13NO6S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzoic acid |
| SMILES | CN1C(C(=O)c2cccc(C(=O)O)c2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H13NO6S/c1-18-14(15(19)10-5-4-6-11(9-10)17(21)22)16(20)12-7-2-3-8-13(12)25(18,23)24/h2-9,14H,1H3,(H,21,22) |
| InChIKey | KRPSRMOHLBRPQL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|