C21H22N2O5S — CID 57377710
2-(3-benzoyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-2-yl)-N,N-diethylacetamide (PubChem CID 57377710) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-(3-benzoyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-2-yl)-N,N-diethylacetamide.
| Compound Name | 2-(3-benzoyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-2-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 57377710 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-(3-benzoyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-2-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1C(C(=O)c2ccccc2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H22N2O5S/c1-3-22(4-2)18(24)14-23-19(20(25)15-10-6-5-7-11-15)21(26)16-12-8-9-13-17(16)29(23,27)28/h5-13,19H,3-4,14H2,1-2H3 |
| InChIKey | NFZHWUOELGMAEH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|