C21H24N2O3S — CID 7367131
[(3S)-4-tert-butylimino-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-3-yl]-phenylmethanone (PubChem CID 7367131) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is [(3S)-4-tert-butylimino-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-3-yl]-phenylmethanone.
| Compound Name | [(3S)-4-tert-butylimino-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7367131 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [(3S)-4-tert-butylimino-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-3-yl]-phenylmethanone |
| SMILES | CCN1[C@H](C(=O)c2ccccc2)/C(=N/C(C)(C)C)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H24N2O3S/c1-5-23-19(20(24)15-11-7-6-8-12-15)18(22-21(2,3)4)16-13-9-10-14-17(16)27(23,25)26/h6-14,19H,5H2,1-4H3/b22-18+/t19-/m0/s1 |
| InChIKey | SCDRENIFJXKSES-HXTJDARSSA-N |
| XLogP | 3.55 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|