C17H14N2O5S — CID 90821398
3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzamide (PubChem CID 90821398) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzamide.
| Compound Name | 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzamide |
|---|---|
| PubChem CID | 90821398 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzamide |
| SMILES | CN1C(C(=O)c2cccc(C(N)=O)c2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H14N2O5S/c1-19-14(15(20)10-5-4-6-11(9-10)17(18)22)16(21)12-7-2-3-8-13(12)25(19,23)24/h2-9,14H,1H3,(H2,18,22) |
| InChIKey | SPZPJUDBXKLSGY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|