C17H16N4O5S — CID 91045461
2-methyl-N-[6-(methylcarbamoyl)-2-pyridinyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 91045461) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 2-methyl-N-[6-(methylcarbamoyl)-2-pyridinyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 2-methyl-N-[6-(methylcarbamoyl)-2-pyridinyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 91045461 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-methyl-N-[6-(methylcarbamoyl)-2-pyridinyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C2C(=O)c3ccccc3S(=O)(=O)N2C)n1 |
| InChI | InChI=1S/C17H16N4O5S/c1-18-16(23)11-7-5-9-13(19-11)20-17(24)14-15(22)10-6-3-4-8-12(10)27(25,26)21(14)2/h3-9,14H,1-2H3,(H,18,23)(H,19,20,24) |
| InChIKey | IORBLQSQCMUZBT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|