C18H14ClN3O4S2 — CID 54462286
7-chloro-2-methyl-N-(6-methyl-2-pyridinyl)-1,1,4-trioxo-3H-[1]benzothiolo[2,3-e]thiazine-3-carboxamide (PubChem CID 54462286) has the molecular formula C18H14ClN3O4S2 and a molecular weight of 435.91 g/mol. Its IUPAC name is 7-chloro-2-methyl-N-(6-methyl-2-pyridinyl)-1,1,4-trioxo-3H-[1]benzothiolo[2,3-e]thiazine-3-carboxamide.
| Compound Name | 7-chloro-2-methyl-N-(6-methyl-2-pyridinyl)-1,1,4-trioxo-3H-[1]benzothiolo[2,3-e]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 54462286 |
| Molecular Formula | C18H14ClN3O4S2 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 7-chloro-2-methyl-N-(6-methyl-2-pyridinyl)-1,1,4-trioxo-3H-[1]benzothiolo[2,3-e]thiazine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2C(=O)c3sc4cc(Cl)ccc4c3S(=O)(=O)N2C)n1 |
| InChI | InChI=1S/C18H14ClN3O4S2/c1-9-4-3-5-13(20-9)21-18(24)14-15(23)16-17(28(25,26)22(14)2)11-7-6-10(19)8-12(11)27-16/h3-8,14H,1-2H3,(H,20,21,24) |
| InChIKey | XCLBVOZGNYVCLV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|