C20H24N4O2 — CID 25469709
1-N,4-N-bis(6-methyl-2-pyridinyl)cyclohexane-1,4-dicarboxamide (PubChem CID 25469709) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-N,4-N-bis(6-methyl-2-pyridinyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(6-methyl-2-pyridinyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 25469709 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-N,4-N-bis(6-methyl-2-pyridinyl)cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCC(C(=O)Nc3cccc(C)n3)CC2)n1 |
| InChI | InChI=1S/C20H24N4O2/c1-13-5-3-7-17(21-13)23-19(25)15-9-11-16(12-10-15)20(26)24-18-8-4-6-14(2)22-18/h3-8,15-16H,9-12H2,1-2H3,(H,21,23,25)(H,22,24,26) |
| InChIKey | AGOLYPXNOJBKKZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |