C19H23N3O5S2 — CID 16935097
N-(6-methyl-2-pyridinyl)-1-(2-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16935097) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-1-(2-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(6-methyl-2-pyridinyl)-1-(2-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16935097 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-1-(2-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCN(S(=O)(=O)c3ccccc3S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C19H23N3O5S2/c1-14-6-5-9-18(20-14)21-19(23)15-10-12-22(13-11-15)29(26,27)17-8-4-3-7-16(17)28(2,24)25/h3-9,15H,10-13H2,1-2H3,(H,20,21,23) |
| InChIKey | BLGBCTJBTYWKFR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |